C10H11F3N2O — CID 135070263
(2R)-2-amino-2-benzyl-3,3,3-trifluoropropanamide (PubChem CID 135070263) has the molecular formula C10H11F3N2O and a molecular weight of 232.21 g/mol. Its IUPAC name is (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanamide.
| Compound Name | (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 135070263 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanamide |
| SMILES | NC(=O)[C@](N)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O/c11-10(12,13)9(15,8(14)16)6-7-4-2-1-3-5-7/h1-5H,6,15H2,(H2,14,16)/t9-/m1/s1 |
| InChIKey | FOYXKHCJLYRFIK-SECBINFHSA-N |
| XLogP | 0.97 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |