C11H14N2O3 — CID 134588871
methyl (2S)-2,3-diamino-2-benzyl-3-oxopropanoate (PubChem CID 134588871) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl (2S)-2,3-diamino-2-benzyl-3-oxopropanoate.
| Compound Name | methyl (2S)-2,3-diamino-2-benzyl-3-oxopropanoate |
|---|---|
| PubChem CID | 134588871 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | methyl (2S)-2,3-diamino-2-benzyl-3-oxopropanoate |
| SMILES | COC(=O)[C@](N)(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C11H14N2O3/c1-16-10(15)11(13,9(12)14)7-8-5-3-2-4-6-8/h2-6H,7,13H2,1H3,(H2,12,14)/t11-/m0/s1 |
| InChIKey | HLXFPISTIPGYED-NSHDSACASA-N |
| XLogP | -0.42 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|