C20H19F2NO4 — CID 132851241
1-O-benzyl 5-O-methyl (E)-4-amino-4-benzyl-2,3-difluoropent-2-enedioate (PubChem CID 132851241) has the molecular formula C20H19F2NO4 and a molecular weight of 375.37 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl (E)-4-amino-4-benzyl-2,3-difluoropent-2-enedioate.
| Compound Name | 1-O-benzyl 5-O-methyl (E)-4-amino-4-benzyl-2,3-difluoropent-2-enedioate |
|---|---|
| PubChem CID | 132851241 |
| Molecular Formula | C20H19F2NO4 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 1-O-benzyl 5-O-methyl (E)-4-amino-4-benzyl-2,3-difluoropent-2-enedioate |
| SMILES | COC(=O)C(N)(Cc1ccccc1)/C(F)=C(\F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H19F2NO4/c1-26-19(25)20(23,12-14-8-4-2-5-9-14)17(22)16(21)18(24)27-13-15-10-6-3-7-11-15/h2-11H,12-13,23H2,1H3/b17-16+ |
| InChIKey | GHGGYVLFSSBRPB-WUKNDPDISA-N |
| XLogP | 2.99 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|