C16H17F2NO6 — CID 132851244
4-O-benzyl 1-O,2-O-dimethyl (E)-2-amino-3,4-difluorobut-3-ene-1,2,4-tricarboxylate (PubChem CID 132851244) has the molecular formula C16H17F2NO6 and a molecular weight of 357.31 g/mol. Its IUPAC name is 4-O-benzyl 1-O,2-O-dimethyl (E)-2-amino-3,4-difluorobut-3-ene-1,2,4-tricarboxylate.
| Compound Name | 4-O-benzyl 1-O,2-O-dimethyl (E)-2-amino-3,4-difluorobut-3-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 132851244 |
| Molecular Formula | C16H17F2NO6 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-O-benzyl 1-O,2-O-dimethyl (E)-2-amino-3,4-difluorobut-3-ene-1,2,4-tricarboxylate |
| SMILES | COC(=O)CC(N)(C(=O)OC)/C(F)=C(\F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H17F2NO6/c1-23-11(20)8-16(19,15(22)24-2)13(18)12(17)14(21)25-9-10-6-4-3-5-7-10/h3-7H,8-9,19H2,1-2H3/b13-12+ |
| InChIKey | QCRKWUURPZMEHU-OUKQBFOZSA-N |
| XLogP | 1.31 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|