C22H14F8O4 — CID 102108055
dibenzyl (2E,4E)-2,5-difluoro-3,4-bis(trifluoromethyl)hexa-2,4-dienedioate (PubChem CID 102108055) has the molecular formula C22H14F8O4 and a molecular weight of 494.33 g/mol. Its IUPAC name is dibenzyl (2E,4E)-2,5-difluoro-3,4-bis(trifluoromethyl)hexa-2,4-dienedioate.
| Compound Name | dibenzyl (2E,4E)-2,5-difluoro-3,4-bis(trifluoromethyl)hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 102108055 |
| Molecular Formula | C22H14F8O4 |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | dibenzyl (2E,4E)-2,5-difluoro-3,4-bis(trifluoromethyl)hexa-2,4-dienedioate |
| SMILES | O=C(OCc1ccccc1)/C(F)=C(C(=C(\F)C(=O)OCc1ccccc1)/C(F)(F)F)\C(F)(F)F |
| InChI | InChI=1S/C22H14F8O4/c23-17(19(31)33-11-13-7-3-1-4-8-13)15(21(25,26)27)16(22(28,29)30)18(24)20(32)34-12-14-9-5-2-6-10-14/h1-10H,11-12H2/b17-15+,18-16+ |
| InChIKey | XBEYDLOVXHDIGS-YTEMWHBBSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|