C15H14F4O2 — CID 177451782
benzyl (2E,5E)-2-fluoro-3-(trifluoromethyl)hepta-2,5-dienoate (PubChem CID 177451782) has the molecular formula C15H14F4O2 and a molecular weight of 302.27 g/mol. Its IUPAC name is benzyl (2E,5E)-2-fluoro-3-(trifluoromethyl)hepta-2,5-dienoate.
| Compound Name | benzyl (2E,5E)-2-fluoro-3-(trifluoromethyl)hepta-2,5-dienoate |
|---|---|
| PubChem CID | 177451782 |
| Molecular Formula | C15H14F4O2 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | benzyl (2E,5E)-2-fluoro-3-(trifluoromethyl)hepta-2,5-dienoate |
| SMILES | C/C=C/C/C(=C(\F)C(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H14F4O2/c1-2-3-9-12(15(17,18)19)13(16)14(20)21-10-11-7-5-4-6-8-11/h2-8H,9-10H2,1H3/b3-2+,13-12+ |
| InChIKey | CPYGTGXTQUFGMW-UIEQPHSRSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|