C17H18F3NO6 — CID 11349776
diethyl (Z)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)but-2-enedioate (PubChem CID 11349776) has the molecular formula C17H18F3NO6 and a molecular weight of 389.33 g/mol. Its IUPAC name is diethyl (Z)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)but-2-enedioate.
| Compound Name | diethyl (Z)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)but-2-enedioate |
|---|---|
| PubChem CID | 11349776 |
| Molecular Formula | C17H18F3NO6 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | diethyl (Z)-2-(phenylmethoxycarbonylamino)-3-(trifluoromethyl)but-2-enedioate |
| SMILES | CCOC(=O)/C(NC(=O)OCc1ccccc1)=C(\C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO6/c1-3-25-14(22)12(17(18,19)20)13(15(23)26-4-2)21-16(24)27-10-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,21,24)/b13-12- |
| InChIKey | OWWPLFXKFHPWDM-SEYXRHQNSA-N |
| XLogP | 2.86 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|