C40H40N2O11 — CID 67665243
ethyl 4-[4-ethoxy-3,4-dioxo-1-phenyl-2-(phenylmethoxycarbonylamino)butoxy]-2-oxo-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 67665243) has the molecular formula C40H40N2O11 and a molecular weight of 724.76 g/mol. Its IUPAC name is ethyl 4-[4-ethoxy-3,4-dioxo-1-phenyl-2-(phenylmethoxycarbonylamino)butoxy]-2-oxo-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | ethyl 4-[4-ethoxy-3,4-dioxo-1-phenyl-2-(phenylmethoxycarbonylamino)butoxy]-2-oxo-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 67665243 |
| Molecular Formula | C40H40N2O11 |
| Molecular Weight | 724.76 g/mol |
| Exact Mass | 724.26 |
| IUPAC Name | ethyl 4-[4-ethoxy-3,4-dioxo-1-phenyl-2-(phenylmethoxycarbonylamino)butoxy]-2-oxo-4-phenyl-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CCOC(=O)C(=O)C(NC(=O)OCc1ccccc1)C(OC(c1ccccc1)C(NC(=O)OCc1ccccc1)C(=O)C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C40H40N2O11/c1-3-49-37(45)33(43)31(41-39(47)51-25-27-17-9-5-10-18-27)35(29-21-13-7-14-22-29)53-36(30-23-15-8-16-24-30)32(34(44)38(46)50-4-2)42-40(48)52-26-28-19-11-6-12-20-28/h5-24,31-32,35-36H,3-4,25-26H2,1-2H3,(H,41,47)(H,42,48) |
| InChIKey | ALOYNJABCNKLJT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.76 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|