C13H12F3NO5 — CID 174584245
(2,2,2-trifluoroacetyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 174584245) has the molecular formula C13H12F3NO5 and a molecular weight of 319.24 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 174584245 |
| Molecular Formula | C13H12F3NO5 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO5/c1-8(10(18)22-11(19)13(14,15)16)17-12(20)21-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,17,20)/t8-/m0/s1 |
| InChIKey | QQLFULHJKQWGLA-QMMMGPOBSA-N |
| XLogP | 1.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|