C15H15F3N2O6 — CID 174413869
(2,2,2-trifluoroacetyl) 5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 174413869) has the molecular formula C15H15F3N2O6 and a molecular weight of 376.29 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 174413869 |
| Molecular Formula | C15H15F3N2O6 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | NC(=O)C(CCC(=O)OC(=O)C(F)(F)F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H15F3N2O6/c16-15(17,18)13(23)26-11(21)7-6-10(12(19)22)20-14(24)25-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,19,22)(H,20,24) |
| InChIKey | ZQWKINCWIWVMJZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|