C16H21NO6 — CID 11001824
2-methylpropoxycarbonyl (2R)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 11001824) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl (2R)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | 2-methylpropoxycarbonyl (2R)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 11001824 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-methylpropoxycarbonyl (2R)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)COC(=O)OC(=O)[C@@H](C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO6/c1-11(2)9-22-16(20)23-14(18)12(3)17-15(19)21-10-13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | ZYJYUYWMNOEKOI-GFCCVEGCSA-N |
| XLogP | 2.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|