C18H25NO6 — CID 86648977
2-methylpropoxycarbonyl (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 86648977) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | 2-methylpropoxycarbonyl (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 86648977 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-methylpropoxycarbonyl (2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)COC(=O)OC(=O)[C@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C18H25NO6/c1-12(2)10-24-18(22)25-16(20)15(13(3)4)19-17(21)23-11-14-8-6-5-7-9-14/h5-9,12-13,15H,10-11H2,1-4H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | UTDZVSLEGHRUCD-OAHLLOKOSA-N |
| XLogP | 3.27 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|