C19H15F6NO4 — CID 123792334
[3,5-bis(trifluoromethyl)phenyl] 2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 123792334) has the molecular formula C19H15F6NO4 and a molecular weight of 435.32 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] 2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] 2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 123792334 |
| Molecular Formula | C19H15F6NO4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] 2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F6NO4/c1-11(26-17(28)29-10-12-5-3-2-4-6-12)16(27)30-15-8-13(18(20,21)22)7-14(9-15)19(23,24)25/h2-9,11H,10H2,1H3,(H,26,28) |
| InChIKey | GMMZDQLFQTUVOK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|