C16H19F2NO4S — CID 132851243
1-O-benzyl 5-O-methyl (E)-4-amino-2,3-difluoro-4-(2-methylsulfanylethyl)pent-2-enedioate (PubChem CID 132851243) has the molecular formula C16H19F2NO4S and a molecular weight of 359.39 g/mol. Its IUPAC name is 1-O-benzyl 5-O-methyl (E)-4-amino-2,3-difluoro-4-(2-methylsulfanylethyl)pent-2-enedioate.
| Compound Name | 1-O-benzyl 5-O-methyl (E)-4-amino-2,3-difluoro-4-(2-methylsulfanylethyl)pent-2-enedioate |
|---|---|
| PubChem CID | 132851243 |
| Molecular Formula | C16H19F2NO4S |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-O-benzyl 5-O-methyl (E)-4-amino-2,3-difluoro-4-(2-methylsulfanylethyl)pent-2-enedioate |
| SMILES | COC(=O)C(N)(CCSC)/C(F)=C(\F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19F2NO4S/c1-22-15(21)16(19,8-9-24-2)13(18)12(17)14(20)23-10-11-6-4-3-5-7-11/h3-7H,8-10,19H2,1-2H3/b13-12+ |
| InChIKey | BHSUZESVJRSYAT-OUKQBFOZSA-N |
| XLogP | 2.50 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|