C15H17F2NO6 — CID 56926837
dimethyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate (PubChem CID 56926837) has the molecular formula C15H17F2NO6 and a molecular weight of 345.30 g/mol. Its IUPAC name is dimethyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate.
| Compound Name | dimethyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 56926837 |
| Molecular Formula | C15H17F2NO6 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | dimethyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate |
| SMILES | COC(=O)C(CC(F)(F)C(=O)OC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H17F2NO6/c1-22-12(19)11(8-15(16,17)13(20)23-2)18-14(21)24-9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H,18,21) |
| InChIKey | MDXIOIAALZBYMM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|