C11H14ClF2NO2 — CID 66973368
methyl (2S)-2-amino-2-benzyl-3,3-difluoropropanoate;hydrochloride (PubChem CID 66973368) has the molecular formula C11H14ClF2NO2 and a molecular weight of 265.69 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-benzyl-3,3-difluoropropanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-2-benzyl-3,3-difluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 66973368 |
| Molecular Formula | C11H14ClF2NO2 |
| Molecular Weight | 265.69 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | methyl (2S)-2-amino-2-benzyl-3,3-difluoropropanoate;hydrochloride |
| SMILES | COC(=O)[C@@](N)(Cc1ccccc1)C(F)F.Cl |
| InChI | InChI=1S/C11H13F2NO2.ClH/c1-16-10(15)11(14,9(12)13)7-8-5-3-2-4-6-8;/h2-6,9H,7,14H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | RAIWGLAXAWOMJA-RFVHGSKJSA-N |
| XLogP | 1.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.69 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |