C14H20ClN3O4 — CID 174308229
methyl 2,4,6-triamino-2-benzyl-3,6-dioxohexanoate;hydrochloride (PubChem CID 174308229) has the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. Its IUPAC name is methyl 2,4,6-triamino-2-benzyl-3,6-dioxohexanoate;hydrochloride.
| Compound Name | methyl 2,4,6-triamino-2-benzyl-3,6-dioxohexanoate;hydrochloride |
|---|---|
| PubChem CID | 174308229 |
| Molecular Formula | C14H20ClN3O4 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | methyl 2,4,6-triamino-2-benzyl-3,6-dioxohexanoate;hydrochloride |
| SMILES | COC(=O)C(N)(Cc1ccccc1)C(=O)C(N)CC(N)=O.Cl |
| InChI | InChI=1S/C14H19N3O4.ClH/c1-21-13(20)14(17,8-9-5-3-2-4-6-9)12(19)10(15)7-11(16)18;/h2-6,10H,7-8,15,17H2,1H3,(H2,16,18);1H |
| InChIKey | DVAOQAATJXHEJG-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|