C16H22N2O5S — CID 70445519
(3S,5R)-3,5-diamino-5-[(2,6-dimethylphenyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid (PubChem CID 70445519) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is (3S,5R)-3,5-diamino-5-[(2,6-dimethylphenyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid.
| Compound Name | (3S,5R)-3,5-diamino-5-[(2,6-dimethylphenyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 70445519 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (3S,5R)-3,5-diamino-5-[(2,6-dimethylphenyl)sulfanylmethyl]-6-methoxy-4,6-dioxohexanoic acid |
| SMILES | COC(=O)[C@@](N)(CSc1c(C)cccc1C)C(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C16H22N2O5S/c1-9-5-4-6-10(2)13(9)24-8-16(18,15(22)23-3)14(21)11(17)7-12(19)20/h4-6,11H,7-8,17-18H2,1-3H3,(H,19,20)/t11-,16+/m0/s1 |
| InChIKey | WABVYQRFPAOVPV-MEDUHNTESA-N |
| XLogP | 0.64 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|