C18H32N2O5S — CID 70446475
(3S,5R)-3,5-diamino-6-methoxy-5-[2-(4-methylcyclohexyl)propylsulfanylmethyl]-4,6-dioxohexanoic acid (PubChem CID 70446475) has the molecular formula C18H32N2O5S and a molecular weight of 388.53 g/mol. Its IUPAC name is (3S,5R)-3,5-diamino-6-methoxy-5-[2-(4-methylcyclohexyl)propylsulfanylmethyl]-4,6-dioxohexanoic acid.
| Compound Name | (3S,5R)-3,5-diamino-6-methoxy-5-[2-(4-methylcyclohexyl)propylsulfanylmethyl]-4,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 70446475 |
| Molecular Formula | C18H32N2O5S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (3S,5R)-3,5-diamino-6-methoxy-5-[2-(4-methylcyclohexyl)propylsulfanylmethyl]-4,6-dioxohexanoic acid |
| SMILES | COC(=O)[C@@](N)(CSCC(C)C1CCC(C)CC1)C(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C18H32N2O5S/c1-11-4-6-13(7-5-11)12(2)9-26-10-18(20,17(24)25-3)16(23)14(19)8-15(21)22/h11-14H,4-10,19-20H2,1-3H3,(H,21,22)/t11?,12?,13?,14-,18+/m0/s1 |
| InChIKey | OSWJWTDBFMMSOL-PUDWMNOGSA-N |
| XLogP | 1.42 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|