C14H24N2O4 — CID 18605566
(3S)-3-amino-4-[1-(dicyclopropylmethoxy)propan-2-ylamino]-4-oxobutanoic acid (PubChem CID 18605566) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is (3S)-3-amino-4-[1-(dicyclopropylmethoxy)propan-2-ylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[1-(dicyclopropylmethoxy)propan-2-ylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18605566 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (3S)-3-amino-4-[1-(dicyclopropylmethoxy)propan-2-ylamino]-4-oxobutanoic acid |
| SMILES | CC(COC(C1CC1)C1CC1)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C14H24N2O4/c1-8(16-14(19)11(15)6-12(17)18)7-20-13(9-2-3-9)10-4-5-10/h8-11,13H,2-7,15H2,1H3,(H,16,19)(H,17,18)/t8?,11-/m0/s1 |
| InChIKey | VJGLJXCVLAMXQJ-LYNSQETBSA-N |
| XLogP | 0.50 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |