C9H14N2O5 — CID 64895375
3-amino-4-[[carboxy(cyclopropyl)methyl]amino]-4-oxobutanoic acid (PubChem CID 64895375) has the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. Its IUPAC name is 3-amino-4-[[carboxy(cyclopropyl)methyl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[carboxy(cyclopropyl)methyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64895375 |
| Molecular Formula | C9H14N2O5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-amino-4-[[carboxy(cyclopropyl)methyl]amino]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C9H14N2O5/c10-5(3-6(12)13)8(14)11-7(9(15)16)4-1-2-4/h4-5,7H,1-3,10H2,(H,11,14)(H,12,13)(H,15,16) |
| InChIKey | OOBHDPGETVVCAC-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |