2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid

C15H23NO3 — CID 112744946

IUPAC2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid
SMILESO=C(O)C(NC(=O)C(C1CCC1)C1CCC1)C1CC1
InChIInChI=1S/C15H23NO3/c17-14(16-13(15(18)19)11-7-8-11)12(9-3-1-4-9)10-5-2-6-10/h9-13H,1-8H2,(H,16,17)(H,18,19)
InChIKeyOQIHWHHJUJZAJL-UHFFFAOYSA-N
MW265.35 g/mol
LogP2.18
Rot. Bonds6

About 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid

2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid (PubChem CID 112744946) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid.

Molecular Properties

Compound Name2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid
PubChem CID112744946
Molecular FormulaC15H23NO3
Molecular Weight265.35 g/mol
Exact Mass265.17
IUPAC Name2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid
SMILESO=C(O)C(NC(=O)C(C1CCC1)C1CCC1)C1CC1
InChIInChI=1S/C15H23NO3/c17-14(16-13(15(18)19)11-7-8-11)12(9-3-1-4-9)10-5-2-6-10/h9-13H,1-8H2,(H,16,17)(H,18,19)
InChIKeyOQIHWHHJUJZAJL-UHFFFAOYSA-N
XLogP2.18
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.35
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid?
The IUPAC name of 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid (CID 112744946) is 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid.
What is the SMILES notation for 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid?
The canonical SMILES for 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid is O=C(O)C(NC(=O)C(C1CCC1)C1CCC1)C1CC1.
What is the InChIKey of 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid?
The InChIKey is OQIHWHHJUJZAJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO3/c17-14(16-13(15(18)19)11-7-8-11)12(9-3-1-4-9)10-5-2-6-10/h9-13H,1-8H2,(H,16,17)(H,18,19).
What are the key properties of 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid?
2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid has a molecular weight of 265.35 g/mol, XLogP of 2.18, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-[[2,2-di(cyclobutyl)acetyl]amino]acetic acid is sourced from PubChem (CID 112744946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).