C7H8Cl3NO3 — CID 101214790
(2S)-2-cyclopropyl-2-[(2,2,2-trichloroacetyl)amino]acetic acid (PubChem CID 101214790) has the molecular formula C7H8Cl3NO3 and a molecular weight of 260.50 g/mol. Its IUPAC name is (2S)-2-cyclopropyl-2-[(2,2,2-trichloroacetyl)amino]acetic acid.
| Compound Name | (2S)-2-cyclopropyl-2-[(2,2,2-trichloroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 101214790 |
| Molecular Formula | C7H8Cl3NO3 |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | (2S)-2-cyclopropyl-2-[(2,2,2-trichloroacetyl)amino]acetic acid |
| SMILES | O=C(O)[C@@H](NC(=O)C(Cl)(Cl)Cl)C1CC1 |
| InChI | InChI=1S/C7H8Cl3NO3/c8-7(9,10)6(14)11-4(5(12)13)3-1-2-3/h3-4H,1-2H2,(H,11,14)(H,12,13)/t4-/m0/s1 |
| InChIKey | BJDGZEDIXMJWAJ-BYPYZUCNSA-N |
| XLogP | 1.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|