2-cyclohexyl-2-(cyclopropylamino)acetic acid

C11H19NO2 — CID 43754546

IUPAC2-cyclohexyl-2-(cyclopropylamino)acetic acid
SMILESO=C(O)C(NC1CC1)C1CCCCC1
InChIInChI=1S/C11H19NO2/c13-11(14)10(12-9-6-7-9)8-4-2-1-3-5-8/h8-10,12H,1-7H2,(H,13,14)
InChIKeyCDOKDLPDTFGGET-UHFFFAOYSA-N
MW197.28 g/mol
LogP1.77
Rot. Bonds4

About 2-cyclohexyl-2-(cyclopropylamino)acetic acid

2-cyclohexyl-2-(cyclopropylamino)acetic acid (PubChem CID 43754546) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-cyclohexyl-2-(cyclopropylamino)acetic acid.

Molecular Properties

Compound Name2-cyclohexyl-2-(cyclopropylamino)acetic acid
PubChem CID43754546
Molecular FormulaC11H19NO2
Molecular Weight197.28 g/mol
Exact Mass197.14
IUPAC Name2-cyclohexyl-2-(cyclopropylamino)acetic acid
SMILESO=C(O)C(NC1CC1)C1CCCCC1
InChIInChI=1S/C11H19NO2/c13-11(14)10(12-9-6-7-9)8-4-2-1-3-5-8/h8-10,12H,1-7H2,(H,13,14)
InChIKeyCDOKDLPDTFGGET-UHFFFAOYSA-N
XLogP1.77
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.28
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-cyclohexyl-2-(cyclopropylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-cyclohexyl-2-(piperidin-4-ylamino)acetic acid;dihydrochloride
CID 68649857
2-cyclopropyl-2-[(4-propan-2-ylcyclohexyl)amino]acetic acid
CID 65061416
2-cyclohexyl-2-(cyclopropylamino)acetamide
CID 60795809
2-(cycloheptylamino)-2-(oxolan-3-yl)acetic acid
CID 54892838
2-(cycloheptylamino)-2-cyclohex-3-en-1-ylacetic acid
CID 54893120
2-cyclopropyl-2-(cyclopropylamino)acetic acid;2-cyclopropyl-2-(cyclopropylamino)acetonitrile
CID 161366805
2-cyclopropyl-2-[(4-propylcyclohexyl)amino]acetic acid
CID 65060463
2-cyclohexyl-2-(difluoromethylsulfonylamino)acetic acid
CID 54901825
2-cyclohexyl-2-[(4-hydroxypiperidine-1-carbonyl)amino]acetic acid
CID 61190973
(2S)-2-(cyclohexylamino)propanoic acid;(2S)-2-(cyclopentylamino)propanoic acid
CID 118008390
2-cyclopropyl-2-[(1-propan-2-ylazepan-4-yl)amino]acetic acid
CID 65077029
2-cyclohexyl-2-(dimethylaminocarbamoylamino)acetic acid
CID 83017392

Frequently Asked Questions

What is the IUPAC name of 2-cyclohexyl-2-(cyclopropylamino)acetic acid?
The IUPAC name of 2-cyclohexyl-2-(cyclopropylamino)acetic acid (CID 43754546) is 2-cyclohexyl-2-(cyclopropylamino)acetic acid.
What is the SMILES notation for 2-cyclohexyl-2-(cyclopropylamino)acetic acid?
The canonical SMILES for 2-cyclohexyl-2-(cyclopropylamino)acetic acid is O=C(O)C(NC1CC1)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-2-(cyclopropylamino)acetic acid?
The InChIKey is CDOKDLPDTFGGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c13-11(14)10(12-9-6-7-9)8-4-2-1-3-5-8/h8-10,12H,1-7H2,(H,13,14).
What are the key properties of 2-cyclohexyl-2-(cyclopropylamino)acetic acid?
2-cyclohexyl-2-(cyclopropylamino)acetic acid has a molecular weight of 197.28 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-(cyclopropylamino)acetic acid is sourced from PubChem (CID 43754546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).