C17H32N2O4 — CID 118008390
(2S)-2-(cyclohexylamino)propanoic acid;(2S)-2-(cyclopentylamino)propanoic acid (PubChem CID 118008390) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2S)-2-(cyclohexylamino)propanoic acid;(2S)-2-(cyclopentylamino)propanoic acid.
| Compound Name | (2S)-2-(cyclohexylamino)propanoic acid;(2S)-2-(cyclopentylamino)propanoic acid |
|---|---|
| PubChem CID | 118008390 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (2S)-2-(cyclohexylamino)propanoic acid;(2S)-2-(cyclopentylamino)propanoic acid |
| SMILES | C[C@H](NC1CCCC1)C(=O)O.C[C@H](NC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C9H17NO2.C8H15NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8;1-6(8(10)11)9-7-4-2-3-5-7/h7-8,10H,2-6H2,1H3,(H,11,12);6-7,9H,2-5H2,1H3,(H,10,11)/t7-;6-/m00/s1 |
| InChIKey | DRQIJLDYMGEUTF-KSTOEEEWSA-N |
| XLogP | 2.37 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |