C15H30N2O4 — CID 69297250
2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid (PubChem CID 69297250) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid.
| Compound Name | 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid |
|---|---|
| PubChem CID | 69297250 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid |
| SMILES | CCCCNCC(=O)O.C[C@H](NC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C9H17NO2.C6H13NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8;1-2-3-4-7-5-6(8)9/h7-8,10H,2-6H2,1H3,(H,11,12);7H,2-5H2,1H3,(H,8,9)/t7-;/m0./s1 |
| InChIKey | VCLMFVMOZFPVDR-FJXQXJEOSA-N |
| XLogP | 1.84 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|