2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid

C15H30N2O4 — CID 69297250

IUPAC2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid
SMILESCCCCNCC(=O)O.C[C@H](NC1CCCCC1)C(=O)O
InChIInChI=1S/C9H17NO2.C6H13NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8;1-2-3-4-7-5-6(8)9/h7-8,10H,2-6H2,1H3,(H,11,12);7H,2-5H2,1H3,(H,8,9)/t7-;/m0./s1
InChIKeyVCLMFVMOZFPVDR-FJXQXJEOSA-N
MW302.42 g/mol
LogP1.84
Rot. Bonds8

About 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid

2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid (PubChem CID 69297250) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid.

Molecular Properties

Compound Name2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid
PubChem CID69297250
Molecular FormulaC15H30N2O4
Molecular Weight302.42 g/mol
Exact Mass302.22
IUPAC Name2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid
SMILESCCCCNCC(=O)O.C[C@H](NC1CCCCC1)C(=O)O
InChIInChI=1S/C9H17NO2.C6H13NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8;1-2-3-4-7-5-6(8)9/h7-8,10H,2-6H2,1H3,(H,11,12);7H,2-5H2,1H3,(H,8,9)/t7-;/m0./s1
InChIKeyVCLMFVMOZFPVDR-FJXQXJEOSA-N
XLogP1.84
TPSA98.66 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.42
LogP ≤ 51.84
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid?
The IUPAC name of 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid (CID 69297250) is 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid.
What is the SMILES notation for 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid?
The canonical SMILES for 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid is CCCCNCC(=O)O.C[C@H](NC1CCCCC1)C(=O)O.
What is the InChIKey of 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid?
The InChIKey is VCLMFVMOZFPVDR-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H17NO2.C6H13NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8;1-2-3-4-7-5-6(8)9/h7-8,10H,2-6H2,1H3,(H,11,12);7H,2-5H2,1H3,(H,8,9)/t7-;/m0./s1.
What are the key properties of 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid?
2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid has a molecular weight of 302.42 g/mol, XLogP of 1.84, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)acetic acid;(2S)-2-(cyclohexylamino)propanoic acid is sourced from PubChem (CID 69297250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).