C17H34N2O4 — CID 159723449
(2S)-2-(cyclohexylamino)propanoic acid;2-(hexylamino)acetic acid (PubChem CID 159723449) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2S)-2-(cyclohexylamino)propanoic acid;2-(hexylamino)acetic acid.
| Compound Name | (2S)-2-(cyclohexylamino)propanoic acid;2-(hexylamino)acetic acid |
|---|---|
| PubChem CID | 159723449 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | (2S)-2-(cyclohexylamino)propanoic acid;2-(hexylamino)acetic acid |
| SMILES | CCCCCCNCC(=O)O.C[C@H](NC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C9H17NO2.C8H17NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8;1-2-3-4-5-6-9-7-8(10)11/h7-8,10H,2-6H2,1H3,(H,11,12);9H,2-7H2,1H3,(H,10,11)/t7-;/m0./s1 |
| InChIKey | NAIIUBVVFLPXRY-FJXQXJEOSA-N |
| XLogP | 2.62 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|