C15H28N2O4 — CID 67882155
1-aminocyclopentane-1-carboxylic acid;(2S)-2-(cyclohexylamino)propanoic acid (PubChem CID 67882155) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-aminocyclopentane-1-carboxylic acid;(2S)-2-(cyclohexylamino)propanoic acid.
| Compound Name | 1-aminocyclopentane-1-carboxylic acid;(2S)-2-(cyclohexylamino)propanoic acid |
|---|---|
| PubChem CID | 67882155 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-aminocyclopentane-1-carboxylic acid;(2S)-2-(cyclohexylamino)propanoic acid |
| SMILES | C[C@H](NC1CCCCC1)C(=O)O.NC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C9H17NO2.C6H11NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8;7-6(5(8)9)3-1-2-4-6/h7-8,10H,2-6H2,1H3,(H,11,12);1-4,7H2,(H,8,9)/t7-;/m0./s1 |
| InChIKey | PLKIRGDWKJKPMT-FJXQXJEOSA-N |
| XLogP | 1.72 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |