C9H15F2NO4S — CID 54901825
2-cyclohexyl-2-(difluoromethylsulfonylamino)acetic acid (PubChem CID 54901825) has the molecular formula C9H15F2NO4S and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-cyclohexyl-2-(difluoromethylsulfonylamino)acetic acid.
| Compound Name | 2-cyclohexyl-2-(difluoromethylsulfonylamino)acetic acid |
|---|---|
| PubChem CID | 54901825 |
| Molecular Formula | C9H15F2NO4S |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-cyclohexyl-2-(difluoromethylsulfonylamino)acetic acid |
| SMILES | O=C(O)C(NS(=O)(=O)C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C9H15F2NO4S/c10-9(11)17(15,16)12-7(8(13)14)6-4-2-1-3-5-6/h6-7,9,12H,1-5H2,(H,13,14) |
| InChIKey | OEVBDXLZKRDTGC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |