C11H21NO6S2 — CID 63245001
2-cyclohexyl-2-(2-methylsulfonylethylsulfonylamino)acetic acid (PubChem CID 63245001) has the molecular formula C11H21NO6S2 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-cyclohexyl-2-(2-methylsulfonylethylsulfonylamino)acetic acid.
| Compound Name | 2-cyclohexyl-2-(2-methylsulfonylethylsulfonylamino)acetic acid |
|---|---|
| PubChem CID | 63245001 |
| Molecular Formula | C11H21NO6S2 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-cyclohexyl-2-(2-methylsulfonylethylsulfonylamino)acetic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NC(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C11H21NO6S2/c1-19(15,16)7-8-20(17,18)12-10(11(13)14)9-5-3-2-4-6-9/h9-10,12H,2-8H2,1H3,(H,13,14) |
| InChIKey | JXKNZZMQPAUTIJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |