2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid

C11H21NO4S — CID 104936044

IUPAC2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid
SMILESCC(C)(C)CCS(=O)(=O)NC(C(=O)O)C1CC1
InChIInChI=1S/C11H21NO4S/c1-11(2,3)6-7-17(15,16)12-9(10(13)14)8-4-5-8/h8-9,12H,4-7H2,1-3H3,(H,13,14)
InChIKeyQBFMXCVJSSNXOW-UHFFFAOYSA-N
MW263.36 g/mol
LogP1.21
Rot. Bonds6

About 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid

2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid (PubChem CID 104936044) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid.

Molecular Properties

Compound Name2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid
PubChem CID104936044
Molecular FormulaC11H21NO4S
Molecular Weight263.36 g/mol
Exact Mass263.12
IUPAC Name2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid
SMILESCC(C)(C)CCS(=O)(=O)NC(C(=O)O)C1CC1
InChIInChI=1S/C11H21NO4S/c1-11(2,3)6-7-17(15,16)12-9(10(13)14)8-4-5-8/h8-9,12H,4-7H2,1-3H3,(H,13,14)
InChIKeyQBFMXCVJSSNXOW-UHFFFAOYSA-N
XLogP1.21
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.36
LogP ≤ 51.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid?
The IUPAC name of 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid (CID 104936044) is 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid.
What is the SMILES notation for 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid?
The canonical SMILES for 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid is CC(C)(C)CCS(=O)(=O)NC(C(=O)O)C1CC1.
What is the InChIKey of 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid?
The InChIKey is QBFMXCVJSSNXOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4S/c1-11(2,3)6-7-17(15,16)12-9(10(13)14)8-4-5-8/h8-9,12H,4-7H2,1-3H3,(H,13,14).
What are the key properties of 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid?
2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid has a molecular weight of 263.36 g/mol, XLogP of 1.21, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid is sourced from PubChem (CID 104936044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).