C11H21NO4S — CID 104936044
2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid (PubChem CID 104936044) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid.
| Compound Name | 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid |
|---|---|
| PubChem CID | 104936044 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-cyclopropyl-2-(3,3-dimethylbutylsulfonylamino)acetic acid |
| SMILES | CC(C)(C)CCS(=O)(=O)NC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C11H21NO4S/c1-11(2,3)6-7-17(15,16)12-9(10(13)14)8-4-5-8/h8-9,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | QBFMXCVJSSNXOW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |