C12H23NO4S — CID 63688223
2-(tert-butylsulfonylamino)-2-cyclohexylacetic acid (PubChem CID 63688223) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-(tert-butylsulfonylamino)-2-cyclohexylacetic acid.
| Compound Name | 2-(tert-butylsulfonylamino)-2-cyclohexylacetic acid |
|---|---|
| PubChem CID | 63688223 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(tert-butylsulfonylamino)-2-cyclohexylacetic acid |
| SMILES | CC(C)(C)S(=O)(=O)NC(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C12H23NO4S/c1-12(2,3)18(16,17)13-10(11(14)15)9-7-5-4-6-8-9/h9-10,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | DWOGSCHXNLFBFB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |