C10H21NO5S — CID 104932555
2-(3,3-dimethylbutylsulfonylamino)-3-hydroxybutanoic acid (PubChem CID 104932555) has the molecular formula C10H21NO5S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylsulfonylamino)-3-hydroxybutanoic acid.
| Compound Name | 2-(3,3-dimethylbutylsulfonylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104932555 |
| Molecular Formula | C10H21NO5S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(3,3-dimethylbutylsulfonylamino)-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NS(=O)(=O)CCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H21NO5S/c1-7(12)8(9(13)14)11-17(15,16)6-5-10(2,3)4/h7-8,11-12H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | AWICHWDYFPHQBK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |