C8H14F3NO5S — CID 83067949
3-hydroxy-2-(4,4,4-trifluorobutylsulfonylamino)butanoic acid (PubChem CID 83067949) has the molecular formula C8H14F3NO5S and a molecular weight of 293.26 g/mol. Its IUPAC name is 3-hydroxy-2-(4,4,4-trifluorobutylsulfonylamino)butanoic acid.
| Compound Name | 3-hydroxy-2-(4,4,4-trifluorobutylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 83067949 |
| Molecular Formula | C8H14F3NO5S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-hydroxy-2-(4,4,4-trifluorobutylsulfonylamino)butanoic acid |
| SMILES | CC(O)C(NS(=O)(=O)CCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H14F3NO5S/c1-5(13)6(7(14)15)12-18(16,17)4-2-3-8(9,10)11/h5-6,12-13H,2-4H2,1H3,(H,14,15) |
| InChIKey | KLEIBTBAUAQGJK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |