C10H18F3NO4S — CID 83068407
3-(4,4,4-trifluorobutylsulfonylamino)hexanoic acid (PubChem CID 83068407) has the molecular formula C10H18F3NO4S and a molecular weight of 305.32 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutylsulfonylamino)hexanoic acid.
| Compound Name | 3-(4,4,4-trifluorobutylsulfonylamino)hexanoic acid |
|---|---|
| PubChem CID | 83068407 |
| Molecular Formula | C10H18F3NO4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-(4,4,4-trifluorobutylsulfonylamino)hexanoic acid |
| SMILES | CCCC(CC(=O)O)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO4S/c1-2-4-8(7-9(15)16)14-19(17,18)6-3-5-10(11,12)13/h8,14H,2-7H2,1H3,(H,15,16) |
| InChIKey | DKSIKRITHRYKFG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |