C9H14F3NO2S — CID 106898603
4,4,4-trifluoro-N-pent-1-yn-3-ylbutane-1-sulfonamide (PubChem CID 106898603) has the molecular formula C9H14F3NO2S and a molecular weight of 257.28 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-pent-1-yn-3-ylbutane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-pent-1-yn-3-ylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 106898603 |
| Molecular Formula | C9H14F3NO2S |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4,4,4-trifluoro-N-pent-1-yn-3-ylbutane-1-sulfonamide |
| SMILES | C#CC(CC)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2S/c1-3-8(4-2)13-16(14,15)7-5-6-9(10,11)12/h1,8,13H,4-7H2,2H3 |
| InChIKey | OEMCTTCUCDHWCV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|