4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid

C10H18F3NO4S — CID 83068023

IUPAC4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid
SMILESCC(C)CC(NS(=O)(=O)CCCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H18F3NO4S/c1-7(2)6-8(9(15)16)14-19(17,18)5-3-4-10(11,12)13/h7-8,14H,3-6H2,1-2H3,(H,15,16)
InChIKeyUFXDGBUSKGBSAE-UHFFFAOYSA-N
MW305.32 g/mol
LogP1.75
Rot. Bonds8

About 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid

4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid (PubChem CID 83068023) has the molecular formula C10H18F3NO4S and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid.

Molecular Properties

Compound Name4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid
PubChem CID83068023
Molecular FormulaC10H18F3NO4S
Molecular Weight305.32 g/mol
Exact Mass305.09
IUPAC Name4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid
SMILESCC(C)CC(NS(=O)(=O)CCCC(F)(F)F)C(=O)O
InChIInChI=1S/C10H18F3NO4S/c1-7(2)6-8(9(15)16)14-19(17,18)5-3-4-10(11,12)13/h7-8,14H,3-6H2,1-2H3,(H,15,16)
InChIKeyUFXDGBUSKGBSAE-UHFFFAOYSA-N
XLogP1.75
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.32
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid?
The IUPAC name of 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid (CID 83068023) is 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid.
What is the SMILES notation for 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid?
The canonical SMILES for 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid is CC(C)CC(NS(=O)(=O)CCCC(F)(F)F)C(=O)O.
What is the InChIKey of 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid?
The InChIKey is UFXDGBUSKGBSAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO4S/c1-7(2)6-8(9(15)16)14-19(17,18)5-3-4-10(11,12)13/h7-8,14H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid?
4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid has a molecular weight of 305.32 g/mol, XLogP of 1.75, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(4,4,4-trifluorobutylsulfonylamino)pentanoic acid is sourced from PubChem (CID 83068023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).