C9H19NO4S — CID 42256033
(2S)-4-methyl-2-(propylsulfonylamino)pentanoic acid (PubChem CID 42256033) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is (2S)-4-methyl-2-(propylsulfonylamino)pentanoic acid.
| Compound Name | (2S)-4-methyl-2-(propylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 42256033 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2S)-4-methyl-2-(propylsulfonylamino)pentanoic acid |
| SMILES | CCCS(=O)(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C9H19NO4S/c1-4-5-15(13,14)10-8(9(11)12)6-7(2)3/h7-8,10H,4-6H2,1-3H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | YLMFVKALSCMEKL-QMMMGPOBSA-N |
| XLogP | 0.82 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |