C9H16F3NO4S — CID 122069291
(2R)-4-methyl-2-(3,3,3-trifluoropropylsulfonylamino)pentanoic acid (PubChem CID 122069291) has the molecular formula C9H16F3NO4S and a molecular weight of 291.29 g/mol. Its IUPAC name is (2R)-4-methyl-2-(3,3,3-trifluoropropylsulfonylamino)pentanoic acid.
| Compound Name | (2R)-4-methyl-2-(3,3,3-trifluoropropylsulfonylamino)pentanoic acid |
|---|---|
| PubChem CID | 122069291 |
| Molecular Formula | C9H16F3NO4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (2R)-4-methyl-2-(3,3,3-trifluoropropylsulfonylamino)pentanoic acid |
| SMILES | CC(C)C[C@@H](NS(=O)(=O)CCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H16F3NO4S/c1-6(2)5-7(8(14)15)13-18(16,17)4-3-9(10,11)12/h6-7,13H,3-5H2,1-2H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | UCDUYTGXKLGFKE-SSDOTTSWSA-N |
| XLogP | 1.36 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |