C11H23NO4S — CID 106727471
4-methyl-2-(2-propan-2-ylsulfonylethylamino)pentanoic acid (PubChem CID 106727471) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-methyl-2-(2-propan-2-ylsulfonylethylamino)pentanoic acid.
| Compound Name | 4-methyl-2-(2-propan-2-ylsulfonylethylamino)pentanoic acid |
|---|---|
| PubChem CID | 106727471 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-methyl-2-(2-propan-2-ylsulfonylethylamino)pentanoic acid |
| SMILES | CC(C)CC(NCCS(=O)(=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C11H23NO4S/c1-8(2)7-10(11(13)14)12-5-6-17(15,16)9(3)4/h8-10,12H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | YIJAWVVOEPXGFK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |