C8H15NO4 — CID 15691184
(2S)-2-(carboxymethylamino)-4-methylpentanoic acid (PubChem CID 15691184) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (2S)-2-(carboxymethylamino)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(carboxymethylamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 15691184 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (2S)-2-(carboxymethylamino)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4/c1-5(2)3-6(8(12)13)9-4-7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | GMJKDYXVGSEHNB-LURJTMIESA-N |
| XLogP | 0.16 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |