2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid

C9H17NO3 — CID 134236014

IUPAC2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid
SMILESCC(C)C[C@H](C)C(=O)NCC(=O)O
InChIInChI=1S/C9H17NO3/c1-6(2)4-7(3)9(13)10-5-8(11)12/h6-7H,4-5H2,1-3H3,(H,10,13)(H,11,12)/t7-/m0/s1
InChIKeyNSYSFSLRCRMJIV-ZETCQYMHSA-N
MW187.24 g/mol
LogP0.87
Rot. Bonds5

About 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid

2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid (PubChem CID 134236014) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid
PubChem CID134236014
Molecular FormulaC9H17NO3
Molecular Weight187.24 g/mol
Exact Mass187.12
IUPAC Name2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid
SMILESCC(C)C[C@H](C)C(=O)NCC(=O)O
InChIInChI=1S/C9H17NO3/c1-6(2)4-7(3)9(13)10-5-8(11)12/h6-7H,4-5H2,1-3H3,(H,10,13)(H,11,12)/t7-/m0/s1
InChIKeyNSYSFSLRCRMJIV-ZETCQYMHSA-N
XLogP0.87
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.24
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid?
The IUPAC name of 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid (CID 134236014) is 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid.
What is the SMILES notation for 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid?
The canonical SMILES for 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid is CC(C)C[C@H](C)C(=O)NCC(=O)O.
What is the InChIKey of 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid?
The InChIKey is NSYSFSLRCRMJIV-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H17NO3/c1-6(2)4-7(3)9(13)10-5-8(11)12/h6-7H,4-5H2,1-3H3,(H,10,13)(H,11,12)/t7-/m0/s1.
What are the key properties of 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid?
2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid has a molecular weight of 187.24 g/mol, XLogP of 0.87, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-2,4-dimethylpentanoyl]amino]acetic acid is sourced from PubChem (CID 134236014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).