C10H22N3NaO4 — CID 172768548
sodium;2-[[(2S)-2-(2,2-dimethylhydrazinyl)-4-methylpentanoyl]amino]acetic acid;hydroxide (PubChem CID 172768548) has the molecular formula C10H22N3NaO4 and a molecular weight of 271.29 g/mol. Its IUPAC name is sodium;2-[[(2S)-2-(2,2-dimethylhydrazinyl)-4-methylpentanoyl]amino]acetic acid;hydroxide.
| Compound Name | sodium;2-[[(2S)-2-(2,2-dimethylhydrazinyl)-4-methylpentanoyl]amino]acetic acid;hydroxide |
|---|---|
| PubChem CID | 172768548 |
| Molecular Formula | C10H22N3NaO4 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | sodium;2-[[(2S)-2-(2,2-dimethylhydrazinyl)-4-methylpentanoyl]amino]acetic acid;hydroxide |
| SMILES | CC(C)C[C@H](NN(C)C)C(=O)NCC(=O)O.[Na+].[OH-] |
| InChI | InChI=1S/C10H21N3O3.Na.H2O/c1-7(2)5-8(12-13(3)4)10(16)11-6-9(14)15;;/h7-8,12H,5-6H2,1-4H3,(H,11,16)(H,14,15);;1H2/q;+1;/p-1/t8-;;/m0../s1 |
| InChIKey | MQJNEDCOEBQEQH-JZGIKJSDSA-M |
| XLogP | -3.50 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|