C11H21N3O5 — CID 145457797
2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]acetic acid (PubChem CID 145457797) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 145457797 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CO)C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-6(2)3-8(11(19)13-4-9(16)17)14-10(18)7(12)5-15/h6-8,15H,3-5,12H2,1-2H3,(H,13,19)(H,14,18)(H,16,17)/t7-,8-/m0/s1 |
| InChIKey | XNCUYZKGQOCOQH-YUMQZZPRSA-N |
| XLogP | -1.96 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |