C10H17N3O7 — CID 18223886
4-[(2-amino-3-hydroxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid (PubChem CID 18223886) has the molecular formula C10H17N3O7 and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-[(2-amino-3-hydroxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid.
| Compound Name | 4-[(2-amino-3-hydroxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18223886 |
| Molecular Formula | C10H17N3O7 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-[(2-amino-3-hydroxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid |
| SMILES | NC(CO)C(=O)NC(CCC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H17N3O7/c11-5(4-14)9(19)13-6(1-2-7(15)16)10(20)12-3-8(17)18/h5-6,14H,1-4,11H2,(H,12,20)(H,13,19)(H,15,16)(H,17,18) |
| InChIKey | YRBGKVIWMNEVCZ-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |