C11H17N3O8 — CID 18219463
4-[(2-amino-3-carboxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid (PubChem CID 18219463) has the molecular formula C11H17N3O8 and a molecular weight of 319.27 g/mol. Its IUPAC name is 4-[(2-amino-3-carboxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid.
| Compound Name | 4-[(2-amino-3-carboxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18219463 |
| Molecular Formula | C11H17N3O8 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-[(2-amino-3-carboxypropanoyl)amino]-5-(carboxymethylamino)-5-oxopentanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H17N3O8/c12-5(3-8(17)18)10(21)14-6(1-2-7(15)16)11(22)13-4-9(19)20/h5-6H,1-4,12H2,(H,13,22)(H,14,21)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | VFUXXFVCYZPOQG-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |