C9H18N4O4 — CID 90787116
(2R)-2-(carboxymethylamino)-5-(diaminomethylideneamino)-4-methylpentanoic acid (PubChem CID 90787116) has the molecular formula C9H18N4O4 and a molecular weight of 246.27 g/mol. Its IUPAC name is (2R)-2-(carboxymethylamino)-5-(diaminomethylideneamino)-4-methylpentanoic acid.
| Compound Name | (2R)-2-(carboxymethylamino)-5-(diaminomethylideneamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 90787116 |
| Molecular Formula | C9H18N4O4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (2R)-2-(carboxymethylamino)-5-(diaminomethylideneamino)-4-methylpentanoic acid |
| SMILES | CC(CN=C(N)N)C[C@@H](NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H18N4O4/c1-5(3-13-9(10)11)2-6(8(16)17)12-4-7(14)15/h5-6,12H,2-4H2,1H3,(H,14,15)(H,16,17)(H4,10,11,13)/t5?,6-/m1/s1 |
| InChIKey | BEUMZLYCBRLYSB-PRJDIBJQSA-N |
| XLogP | -1.59 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|