C12H25N5O4 — CID 174652219
(2S)-2-[2-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]hydrazinyl]-4-methylpentanoic acid (PubChem CID 174652219) has the molecular formula C12H25N5O4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2S)-2-[2-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]hydrazinyl]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[2-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]hydrazinyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 174652219 |
| Molecular Formula | C12H25N5O4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2S)-2-[2-[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]hydrazinyl]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NN[C@@H](CCCN=C(N)N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H25N5O4/c1-7(2)6-9(11(20)21)17-16-8(10(18)19)4-3-5-15-12(13)14/h7-9,16-17H,3-6H2,1-2H3,(H,18,19)(H,20,21)(H4,13,14,15)/t8-,9-/m0/s1 |
| InChIKey | PFQZAKNVAHMVOB-IUCAKERBSA-N |
| XLogP | -0.91 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|