C7H15N5O4 — CID 54298748
(2S)-5-(diaminomethylideneamino)-4-methyl-2-nitramidopentanoic acid (PubChem CID 54298748) has the molecular formula C7H15N5O4 and a molecular weight of 233.23 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-4-methyl-2-nitramidopentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-4-methyl-2-nitramidopentanoic acid |
|---|---|
| PubChem CID | 54298748 |
| Molecular Formula | C7H15N5O4 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-4-methyl-2-nitramidopentanoic acid |
| SMILES | CC(CN=C(N)N)C[C@H](N[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C7H15N5O4/c1-4(3-10-7(8)9)2-5(6(13)14)11-12(15)16/h4-5,11H,2-3H2,1H3,(H,13,14)(H4,8,9,10)/t4?,5-/m0/s1 |
| InChIKey | SCRAASIOMMISAH-AKGZTFGVSA-N |
| XLogP | -1.48 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|