C7H16ClN5O4 — CID 18601581
methyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate;hydrochloride (PubChem CID 18601581) has the molecular formula C7H16ClN5O4 and a molecular weight of 269.69 g/mol. Its IUPAC name is methyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate;hydrochloride.
| Compound Name | methyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate;hydrochloride |
|---|---|
| PubChem CID | 18601581 |
| Molecular Formula | C7H16ClN5O4 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate;hydrochloride |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)N[N+](=O)[O-].Cl |
| InChI | InChI=1S/C7H15N5O4.ClH/c1-16-6(13)5(11-12(14)15)3-2-4-10-7(8)9;/h5,11H,2-4H2,1H3,(H4,8,9,10);1H/t5-;/m0./s1 |
| InChIKey | NKNIIMOFSJEINW-JEDNCBNOSA-N |
| XLogP | -1.22 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|